SENP1-IN-8e is a sentrin-specific protease 1 (senp1) inhibitor
MedKoo Cat#: 565530
Name: SENP1-IN-8e
CAS#: O=C(OCC(C1=CC=C(Cl)C=C1)=O)C2=CC=C(NC(C3=CC=CC(OCC4=CC=CC=C4)=C3)=O)C=C2
Chemical Formula: C29H22ClNO5
Exact Mass: 499.1187
Molecular Weight: 499.95
Elemental Analysis: C, 69.67; H, 4.44; Cl, 7.09; N, 2.80; O, 16.00
The following data is based on the product molecular weight 499.95 Batch specific molecular weights may vary from batch to batch due to the degree of hydration, which will affect the solvent volumes required to prepare stock solutions.
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 1 mM | 1.15 mL | 5.76 mL | 11.51 mL |
| 5 mM | 0.23 mL | 1.15 mL | 2.3 mL |
| 10 mM | 0.12 mL | 0.58 mL | 1.15 mL |
| 50 mM | 0.02 mL | 0.12 mL | 0.23 mL |